| HILFOS |
|
|
| |
|
|
Insecticide |
|
|
| |
|
|
| Common Name |
: |
Profenfos |
| |
|
|
| Chemical Name |
: |
O-(4-bromo-2-Chlorophenyl) O-ehtyl
S-propylphosphorothioate |
| |
|
|
| Empirical Formula |
: |
C11H15BrClO3PS |
| |
|
|
| Available Formulation |
: |
Profenofos - 50% w/w EC |
| |
|
|
| Activity |
: |
Insecticide |
| |
|
|
| Mode of Action |
: |
Non systemic insecticide with contact & Stomach action. Exhibits a translaminar effect. Has an ovicidal properties |
| |
|
|
| Uses |
: |
Control of sucking & chewing insect pests of cotton, Maize, Paddy, Soya bean, Vegetables & other crops. |
| |
|
|
| Packing Size |
: |
Available in 100 ml, 250ml, 500ml, 1.0 ltr, 5 ltr tin containers. |
| |
|
|
